About 3H-quinolin-2-imine
3H-quinolin-2-imine (PubChem CID 101216919) has the molecular formula C9H8N2
and a molecular weight of 144.18 g/mol. Its IUPAC name is 3H-quinolin-2-imine.
Molecular Properties
| Compound Name | 3H-quinolin-2-imine |
| PubChem CID | 101216919 |
| Molecular Formula | C9H8N2 |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 3H-quinolin-2-imine |
| SMILES | [H]/N=C1\CC=c2ccccc2=N1 |
| InChI | InChI=1S/C9H8N2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-5,10H,6H2/b10-9+ |
| InChIKey | KSSRKUKLPKEYCZ-MDZDMXLPSA-N |
| XLogP | 0.47 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3H-quinolin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-quinolin-2-imine?
The IUPAC name of 3H-quinolin-2-imine (CID 101216919) is 3H-quinolin-2-imine.
What is the SMILES notation for 3H-quinolin-2-imine?
The canonical SMILES for 3H-quinolin-2-imine is [H]/N=C1\CC=c2ccccc2=N1.
What is the InChIKey of 3H-quinolin-2-imine?
The InChIKey is KSSRKUKLPKEYCZ-MDZDMXLPSA-N. The full InChI is InChI=1S/C9H8N2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-5,10H,6H2/b10-9+.
What are the key properties of 3H-quinolin-2-imine?
3H-quinolin-2-imine has a molecular weight of 144.18 g/mol, XLogP of 0.47, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-quinolin-2-imine is sourced from PubChem (CID 101216919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).