C10H6N4 — CID 68522826
2,3-diiminoquinoline-4-carbonitrile (PubChem CID 68522826) has the molecular formula C10H6N4 and a molecular weight of 182.19 g/mol. Its IUPAC name is 2,3-diiminoquinoline-4-carbonitrile.
| Compound Name | 2,3-diiminoquinoline-4-carbonitrile |
|---|---|
| PubChem CID | 68522826 |
| Molecular Formula | C10H6N4 |
| Molecular Weight | 182.19 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 2,3-diiminoquinoline-4-carbonitrile |
| SMILES | [H]/N=C1\N=c2ccccc2=C(C#N)\C1=N\[H] |
| InChI | InChI=1S/C10H6N4/c11-5-7-6-3-1-2-4-8(6)14-10(13)9(7)12/h1-4,12-13H/b12-9-,13-10- |
| InChIKey | ZYBNOCIYDSMFQF-QKFASICWSA-N |
| XLogP | -0.01 |
| TPSA | 83.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.19 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|