C18H15F3N4OS2 — CID 139294236
2-[(6R)-2-methyl-3-sulfanylidene-6-(2,3,6-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]-N-(1,2-thiazol-4-yl)acetamide (PubChem CID 139294236) has the molecular formula C18H15F3N4OS2 and a molecular weight of 424.47 g/mol. Its IUPAC name is 2-[(6R)-2-methyl-3-sulfanylidene-6-(2,3,6-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]-N-(1,2-thiazol-4-yl)acetamide.
| Compound Name | 2-[(6R)-2-methyl-3-sulfanylidene-6-(2,3,6-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]-N-(1,2-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 139294236 |
| Molecular Formula | C18H15F3N4OS2 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 2-[(6R)-2-methyl-3-sulfanylidene-6-(2,3,6-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]-N-(1,2-thiazol-4-yl)acetamide |
| SMILES | Cn1c(CC(=O)Nc2cnsc2)c2n(c1=S)C[C@@H](c1c(F)ccc(F)c1F)C2 |
| InChI | InChI=1S/C18H15F3N4OS2/c1-24-13(5-15(26)23-10-6-22-28-8-10)14-4-9(7-25(14)18(24)27)16-11(19)2-3-12(20)17(16)21/h2-3,6,8-9H,4-5,7H2,1H3,(H,23,26)/t9-/m0/s1 |
| InChIKey | QMINUKMOLLCBTI-VIFPVBQESA-N |
| XLogP | 3.95 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|