C14H22N2O6 — CID 139301451
bis(4,4-dimethyl-1,3-oxazolidin-2-yl) (E)-but-2-enedioate (PubChem CID 139301451) has the molecular formula C14H22N2O6 and a molecular weight of 314.34 g/mol. Its IUPAC name is bis(4,4-dimethyl-1,3-oxazolidin-2-yl) (E)-but-2-enedioate.
| Compound Name | bis(4,4-dimethyl-1,3-oxazolidin-2-yl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 139301451 |
| Molecular Formula | C14H22N2O6 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | bis(4,4-dimethyl-1,3-oxazolidin-2-yl) (E)-but-2-enedioate |
| SMILES | CC1(C)COC(OC(=O)/C=C/C(=O)OC2NC(C)(C)CO2)N1 |
| InChI | InChI=1S/C14H22N2O6/c1-13(2)7-19-11(15-13)21-9(17)5-6-10(18)22-12-16-14(3,4)8-20-12/h5-6,11-12,15-16H,7-8H2,1-4H3/b6-5+ |
| InChIKey | SFPDKAGBOQKVTF-AATRIKPKSA-N |
| XLogP | -0.01 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|