C20H21FN4O — CID 139309113
4-[5-(7-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-pyridinyl]morpholine (PubChem CID 139309113) has the molecular formula C20H21FN4O and a molecular weight of 352.41 g/mol. Its IUPAC name is 4-[5-(7-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-pyridinyl]morpholine.
| Compound Name | 4-[5-(7-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-pyridinyl]morpholine |
|---|---|
| PubChem CID | 139309113 |
| Molecular Formula | C20H21FN4O |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 4-[5-(7-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-pyridinyl]morpholine |
| SMILES | Fc1ccc2c3c([nH]c2c1)CCN(c1ccc(N2CCOCC2)nc1)C3 |
| InChI | InChI=1S/C20H21FN4O/c21-14-1-3-16-17-13-25(6-5-18(17)23-19(16)11-14)15-2-4-20(22-12-15)24-7-9-26-10-8-24/h1-4,11-12,23H,5-10,13H2 |
| InChIKey | KMARVRWKJVVEAH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|