C22H21FN4OS — CID 158988056
4-[5-(6-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1,3-benzothiazol-2-yl]morpholine (PubChem CID 158988056) has the molecular formula C22H21FN4OS and a molecular weight of 408.50 g/mol. Its IUPAC name is 4-[5-(6-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1,3-benzothiazol-2-yl]morpholine.
| Compound Name | 4-[5-(6-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1,3-benzothiazol-2-yl]morpholine |
|---|---|
| PubChem CID | 158988056 |
| Molecular Formula | C22H21FN4OS |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 4-[5-(6-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1,3-benzothiazol-2-yl]morpholine |
| SMILES | Fc1ccc2[nH]c3c(c2c1)CCN(c1ccc2sc(N4CCOCC4)nc2c1)C3 |
| InChI | InChI=1S/C22H21FN4OS/c23-14-1-3-18-17(11-14)16-5-6-27(13-20(16)24-18)15-2-4-21-19(12-15)25-22(29-21)26-7-9-28-10-8-26/h1-4,11-12,24H,5-10,13H2 |
| InChIKey | SQOLKXOORPHMGV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|