C21H23FN4S — CID 153371925
1-[5-(6-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-(methylideneamino)phenyl]sulfanyl-N,N-dimethylmethanamine (PubChem CID 153371925) has the molecular formula C21H23FN4S and a molecular weight of 382.51 g/mol. Its IUPAC name is 1-[5-(6-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-(methylideneamino)phenyl]sulfanyl-N,N-dimethylmethanamine.
| Compound Name | 1-[5-(6-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-(methylideneamino)phenyl]sulfanyl-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 153371925 |
| Molecular Formula | C21H23FN4S |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 1-[5-(6-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-(methylideneamino)phenyl]sulfanyl-N,N-dimethylmethanamine |
| SMILES | C=Nc1ccc(N2CCc3c([nH]c4ccc(F)cc34)C2)cc1SCN(C)C |
| InChI | InChI=1S/C21H23FN4S/c1-23-19-7-5-15(11-21(19)27-13-25(2)3)26-9-8-16-17-10-14(22)4-6-18(17)24-20(16)12-26/h4-7,10-11,24H,1,8-9,12-13H2,2-3H3 |
| InChIKey | BXJQODVHNBCOTP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 34.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|