C43H40ClF3N2O5S — CID 139324189
3-[[4-[2-[4-(4-tert-butylphenyl)phenyl]-3-[4-(4-chloro-2-methylphenyl)-3-(trifluoromethyl)anilino]-3-oxopropyl]benzoyl]amino]-1-oxopropane-1-sulfinic acid (PubChem CID 139324189) has the molecular formula C43H40ClF3N2O5S and a molecular weight of 789.32 g/mol. Its IUPAC name is 3-[[4-[2-[4-(4-tert-butylphenyl)phenyl]-3-[4-(4-chloro-2-methylphenyl)-3-(trifluoromethyl)anilino]-3-oxopropyl]benzoyl]amino]-1-oxopropane-1-sulfinic acid.
| Compound Name | 3-[[4-[2-[4-(4-tert-butylphenyl)phenyl]-3-[4-(4-chloro-2-methylphenyl)-3-(trifluoromethyl)anilino]-3-oxopropyl]benzoyl]amino]-1-oxopropane-1-sulfinic acid |
|---|---|
| PubChem CID | 139324189 |
| Molecular Formula | C43H40ClF3N2O5S |
| Molecular Weight | 789.32 g/mol |
| Exact Mass | 788.23 |
| IUPAC Name | 3-[[4-[2-[4-(4-tert-butylphenyl)phenyl]-3-[4-(4-chloro-2-methylphenyl)-3-(trifluoromethyl)anilino]-3-oxopropyl]benzoyl]amino]-1-oxopropane-1-sulfinic acid |
| SMILES | Cc1cc(Cl)ccc1-c1ccc(NC(=O)C(Cc2ccc(C(=O)NCCC(=O)S(=O)O)cc2)c2ccc(-c3ccc(C(C)(C)C)cc3)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C43H40ClF3N2O5S/c1-26-23-33(44)17-19-35(26)36-20-18-34(25-38(36)43(45,46)47)49-41(52)37(24-27-5-7-31(8-6-27)40(51)48-22-21-39(50)55(53)54)30-11-9-28(10-12-30)29-13-15-32(16-14-29)42(2,3)4/h5-20,23,25,37H,21-22,24H2,1-4H3,(H,48,51)(H,49,52)(H,53,54) |
| InChIKey | HAVKWRKAFFAEES-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.32 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|