C41H44ClN2O5S- — CID 143942536
2-[[4-[(2S)-2-[4-[(4R)-4-tert-butylcyclohexen-1-yl]phenyl]-3-[4-(4-chloro-2-methylphenyl)anilino]-3-oxopropyl]benzoyl]amino]ethanesulfonate (PubChem CID 143942536) has the molecular formula C41H44ClN2O5S- and a molecular weight of 712.33 g/mol. Its IUPAC name is 2-[[4-[(2S)-2-[4-[(4R)-4-tert-butylcyclohexen-1-yl]phenyl]-3-[4-(4-chloro-2-methylphenyl)anilino]-3-oxopropyl]benzoyl]amino]ethanesulfonate.
| Compound Name | 2-[[4-[(2S)-2-[4-[(4R)-4-tert-butylcyclohexen-1-yl]phenyl]-3-[4-(4-chloro-2-methylphenyl)anilino]-3-oxopropyl]benzoyl]amino]ethanesulfonate |
|---|---|
| PubChem CID | 143942536 |
| Molecular Formula | C41H44ClN2O5S- |
| Molecular Weight | 712.33 g/mol |
| Exact Mass | 711.27 |
| IUPAC Name | 2-[[4-[(2S)-2-[4-[(4R)-4-tert-butylcyclohexen-1-yl]phenyl]-3-[4-(4-chloro-2-methylphenyl)anilino]-3-oxopropyl]benzoyl]amino]ethanesulfonate |
| SMILES | Cc1cc(Cl)ccc1-c1ccc(NC(=O)[C@@H](Cc2ccc(C(=O)NCCS(=O)(=O)[O-])cc2)c2ccc(C3=CC[C@H](C(C)(C)C)CC3)cc2)cc1 |
| InChI | InChI=1S/C41H45ClN2O5S/c1-27-25-35(42)19-22-37(27)31-15-20-36(21-16-31)44-40(46)38(26-28-5-7-33(8-6-28)39(45)43-23-24-50(47,48)49)32-11-9-29(10-12-32)30-13-17-34(18-14-30)41(2,3)4/h5-13,15-16,19-22,25,34,38H,14,17-18,23-24,26H2,1-4H3,(H,43,45)(H,44,46)(H,47,48,49)/p-1/t34-,38-/m0/s1 |
| InChIKey | WAYMLSUWPRPJJK-UVNLRBHVSA-M |
| XLogP | 8.79 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.33 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|