C46H61ClN2O5S — CID 144977906
2-[[4-[2-[4-(4-tert-butylcyclohexyl)phenyl]-3-[4-(4-chloro-2-methylphenyl)-2-methylanilino]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid;ethane (PubChem CID 144977906) has the molecular formula C46H61ClN2O5S and a molecular weight of 789.52 g/mol. Its IUPAC name is 2-[[4-[2-[4-(4-tert-butylcyclohexyl)phenyl]-3-[4-(4-chloro-2-methylphenyl)-2-methylanilino]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid;ethane.
| Compound Name | 2-[[4-[2-[4-(4-tert-butylcyclohexyl)phenyl]-3-[4-(4-chloro-2-methylphenyl)-2-methylanilino]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid;ethane |
|---|---|
| PubChem CID | 144977906 |
| Molecular Formula | C46H61ClN2O5S |
| Molecular Weight | 789.52 g/mol |
| Exact Mass | 788.40 |
| IUPAC Name | 2-[[4-[2-[4-(4-tert-butylcyclohexyl)phenyl]-3-[4-(4-chloro-2-methylphenyl)-2-methylanilino]-3-oxopropyl]benzoyl]amino]ethanesulfonic acid;ethane |
| SMILES | CC.CC.Cc1cc(-c2ccc(Cl)cc2C)ccc1NC(=O)C(Cc1ccc(C(=O)NCCS(=O)(=O)O)cc1)c1ccc(C2CCC(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C42H49ClN2O5S.2C2H6/c1-27-25-36(43)19-20-37(27)34-16-21-39(28(2)24-34)45-41(47)38(26-29-6-8-33(9-7-29)40(46)44-22-23-51(48,49)50)32-12-10-30(11-13-32)31-14-17-35(18-15-31)42(3,4)5;2*1-2/h6-13,16,19-21,24-25,31,35,38H,14-15,17-18,22-23,26H2,1-5H3,(H,44,46)(H,45,47)(H,48,49,50);2*1-2H3 |
| InChIKey | HTDIFCMIRYXHHY-UHFFFAOYSA-N |
| XLogP | 11.58 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.52 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|