About 7-ethenyl-5-[2-(1-fluorocyclohexyl)ethyl]-6-[(Z)-prop-1-enyl]-5H-pyrrolo[1,2-c]imidazole
7-ethenyl-5-[2-(1-fluorocyclohexyl)ethyl]-6-[(Z)-prop-1-enyl]-5H-pyrrolo[1,2-c]imidazole (PubChem CID 139334402) has the molecular formula C19H25FN2
and a molecular weight of 300.42 g/mol. Its IUPAC name is 7-ethenyl-5-[2-(1-fluorocyclohexyl)ethyl]-6-[(Z)-prop-1-enyl]-5H-pyrrolo[1,2-c]imidazole.
Molecular Properties
| Compound Name | 7-ethenyl-5-[2-(1-fluorocyclohexyl)ethyl]-6-[(Z)-prop-1-enyl]-5H-pyrrolo[1,2-c]imidazole |
| PubChem CID | 139334402 |
| Molecular Formula | C19H25FN2 |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 7-ethenyl-5-[2-(1-fluorocyclohexyl)ethyl]-6-[(Z)-prop-1-enyl]-5H-pyrrolo[1,2-c]imidazole |
| SMILES | C=CC1=C(/C=C\C)C(CCC2(F)CCCCC2)n2cncc21 |
| InChI | InChI=1S/C19H25FN2/c1-3-8-16-15(4-2)18-13-21-14-22(18)17(16)9-12-19(20)10-6-5-7-11-19/h3-4,8,13-14,17H,2,5-7,9-12H2,1H3/b8-3- |
| InChIKey | AJTFXTYTNWSRQR-BAQGIRSFSA-N |
| XLogP | 5.41 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-ethenyl-5-[2-(1-fluorocyclohexyl)ethyl]-6-[(Z)-prop-1-enyl]-5H-pyrrolo[1,2-c]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethenyl-5-[2-(1-fluorocyclohexyl)ethyl]-6-[(Z)-prop-1-enyl]-5H-pyrrolo[1,2-c]imidazole?
The IUPAC name of 7-ethenyl-5-[2-(1-fluorocyclohexyl)ethyl]-6-[(Z)-prop-1-enyl]-5H-pyrrolo[1,2-c]imidazole (CID 139334402) is 7-ethenyl-5-[2-(1-fluorocyclohexyl)ethyl]-6-[(Z)-prop-1-enyl]-5H-pyrrolo[1,2-c]imidazole.
What is the SMILES notation for 7-ethenyl-5-[2-(1-fluorocyclohexyl)ethyl]-6-[(Z)-prop-1-enyl]-5H-pyrrolo[1,2-c]imidazole?
The canonical SMILES for 7-ethenyl-5-[2-(1-fluorocyclohexyl)ethyl]-6-[(Z)-prop-1-enyl]-5H-pyrrolo[1,2-c]imidazole is C=CC1=C(/C=C\C)C(CCC2(F)CCCCC2)n2cncc21.
What is the InChIKey of 7-ethenyl-5-[2-(1-fluorocyclohexyl)ethyl]-6-[(Z)-prop-1-enyl]-5H-pyrrolo[1,2-c]imidazole?
The InChIKey is AJTFXTYTNWSRQR-BAQGIRSFSA-N. The full InChI is InChI=1S/C19H25FN2/c1-3-8-16-15(4-2)18-13-21-14-22(18)17(16)9-12-19(20)10-6-5-7-11-19/h3-4,8,13-14,17H,2,5-7,9-12H2,1H3/b8-3-.
What are the key properties of 7-ethenyl-5-[2-(1-fluorocyclohexyl)ethyl]-6-[(Z)-prop-1-enyl]-5H-pyrrolo[1,2-c]imidazole?
7-ethenyl-5-[2-(1-fluorocyclohexyl)ethyl]-6-[(Z)-prop-1-enyl]-5H-pyrrolo[1,2-c]imidazole has a molecular weight of 300.42 g/mol, XLogP of 5.41, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethenyl-5-[2-(1-fluorocyclohexyl)ethyl]-6-[(Z)-prop-1-enyl]-5H-pyrrolo[1,2-c]imidazole is sourced from PubChem (CID 139334402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).