C11H13ClO — CID 139354460
7-chloro-1-ethyl-3,4-dihydro-1H-isochromene (PubChem CID 139354460) has the molecular formula C11H13ClO and a molecular weight of 196.68 g/mol. Its IUPAC name is 7-chloro-1-ethyl-3,4-dihydro-1H-isochromene.
| Compound Name | 7-chloro-1-ethyl-3,4-dihydro-1H-isochromene |
|---|---|
| PubChem CID | 139354460 |
| Molecular Formula | C11H13ClO |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 7-chloro-1-ethyl-3,4-dihydro-1H-isochromene |
| SMILES | CCC1OCCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C11H13ClO/c1-2-11-10-7-9(12)4-3-8(10)5-6-13-11/h3-4,7,11H,2,5-6H2,1H3 |
| InChIKey | HFLFUGVMRPSLMY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |