C18H15N — CID 139373276
2-prop-1-en-2-yl-2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yne (PubChem CID 139373276) has the molecular formula C18H15N and a molecular weight of 245.32 g/mol. Its IUPAC name is 2-prop-1-en-2-yl-2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yne.
| Compound Name | 2-prop-1-en-2-yl-2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yne |
|---|---|
| PubChem CID | 139373276 |
| Molecular Formula | C18H15N |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 2-prop-1-en-2-yl-2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yne |
| SMILES | C=C(C)N1Cc2ccccc2C#Cc2ccccc21 |
| InChI | InChI=1S/C18H15N/c1-14(2)19-13-17-9-4-3-7-15(17)11-12-16-8-5-6-10-18(16)19/h3-10H,1,13H2,2H3 |
| InChIKey | VIAJTDBZDIZNNT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|