C25H33N — CID 167663934
2,2-dimethylpropane;2-(2,2-dimethylpropyl)-2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yne (PubChem CID 167663934) has the molecular formula C25H33N and a molecular weight of 347.55 g/mol. Its IUPAC name is 2,2-dimethylpropane;2-(2,2-dimethylpropyl)-2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yne.
| Compound Name | 2,2-dimethylpropane;2-(2,2-dimethylpropyl)-2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yne |
|---|---|
| PubChem CID | 167663934 |
| Molecular Formula | C25H33N |
| Molecular Weight | 347.55 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | 2,2-dimethylpropane;2-(2,2-dimethylpropyl)-2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yne |
| SMILES | CC(C)(C)C.CC(C)(C)CN1Cc2ccccc2C#Cc2ccccc21 |
| InChI | InChI=1S/C20H21N.C5H12/c1-20(2,3)15-21-14-18-10-5-4-8-16(18)12-13-17-9-6-7-11-19(17)21;1-5(2,3)4/h4-11H,14-15H2,1-3H3;1-4H3 |
| InChIKey | SIZBTVDZSVOLTD-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.55 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|