C24H30N2O — CID 168919536
5-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)pentanal;N-methylpropan-2-amine (PubChem CID 168919536) has the molecular formula C24H30N2O and a molecular weight of 362.52 g/mol. Its IUPAC name is 5-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)pentanal;N-methylpropan-2-amine.
| Compound Name | 5-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)pentanal;N-methylpropan-2-amine |
|---|---|
| PubChem CID | 168919536 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 5-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)pentanal;N-methylpropan-2-amine |
| SMILES | CNC(C)C.O=CCCCCN1Cc2ccccc2C#Cc2ccccc21 |
| InChI | InChI=1S/C20H19NO.C4H11N/c22-15-7-1-6-14-21-16-19-10-3-2-8-17(19)12-13-18-9-4-5-11-20(18)21;1-4(2)5-3/h2-5,8-11,15H,1,6-7,14,16H2;4-5H,1-3H3 |
| InChIKey | NVVUNIRWUOUVBI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|