C25H37N — CID 167556352
ethane;2-ethyl-2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yne;propane (PubChem CID 167556352) has the molecular formula C25H37N and a molecular weight of 351.58 g/mol. Its IUPAC name is ethane;2-ethyl-2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yne;propane.
| Compound Name | ethane;2-ethyl-2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yne;propane |
|---|---|
| PubChem CID | 167556352 |
| Molecular Formula | C25H37N |
| Molecular Weight | 351.58 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | ethane;2-ethyl-2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yne;propane |
| SMILES | CC.CCC.CCC.CCN1Cc2ccccc2C#Cc2ccccc21 |
| InChI | InChI=1S/C17H15N.2C3H8.C2H6/c1-2-18-13-16-9-4-3-7-14(16)11-12-15-8-5-6-10-17(15)18;2*1-3-2;1-2/h3-10H,2,13H2,1H3;2*3H2,1-2H3;1-2H3 |
| InChIKey | DBFYWYBVPUZWLC-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.58 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|