C16H13NS — CID 166999220
2-methylsulfanyl-2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yne (PubChem CID 166999220) has the molecular formula C16H13NS and a molecular weight of 251.35 g/mol. Its IUPAC name is 2-methylsulfanyl-2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yne.
| Compound Name | 2-methylsulfanyl-2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yne |
|---|---|
| PubChem CID | 166999220 |
| Molecular Formula | C16H13NS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 2-methylsulfanyl-2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yne |
| SMILES | CSN1Cc2ccccc2C#Cc2ccccc21 |
| InChI | InChI=1S/C16H13NS/c1-18-17-12-15-8-3-2-6-13(15)10-11-14-7-4-5-9-16(14)17/h2-9H,12H2,1H3 |
| InChIKey | DKBGNCXXXHTAIT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|