C19H20FN4O2P — CID 139396017
3-[7-amino-1-(cyclopropylmethylamino)-2,6-naphthyridin-3-yl]-4-fluoro-5-methoxy-2-phosphanylphenol (PubChem CID 139396017) has the molecular formula C19H20FN4O2P and a molecular weight of 386.37 g/mol. Its IUPAC name is 3-[7-amino-1-(cyclopropylmethylamino)-2,6-naphthyridin-3-yl]-4-fluoro-5-methoxy-2-phosphanylphenol.
| Compound Name | 3-[7-amino-1-(cyclopropylmethylamino)-2,6-naphthyridin-3-yl]-4-fluoro-5-methoxy-2-phosphanylphenol |
|---|---|
| PubChem CID | 139396017 |
| Molecular Formula | C19H20FN4O2P |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 3-[7-amino-1-(cyclopropylmethylamino)-2,6-naphthyridin-3-yl]-4-fluoro-5-methoxy-2-phosphanylphenol |
| SMILES | COc1cc(O)c(P)c(-c2cc3cnc(N)cc3c(NCC3CC3)n2)c1F |
| InChI | InChI=1S/C19H20FN4O2P/c1-26-14-6-13(25)18(27)16(17(14)20)12-4-10-8-22-15(21)5-11(10)19(24-12)23-7-9-2-3-9/h4-6,8-9,25H,2-3,7,27H2,1H3,(H2,21,22)(H,23,24) |
| InChIKey | UFQFGPZOWRKUQN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|