C20H24N4O — CID 139431861
(3S)-3-methyl-1-[1-(oxan-4-yl)pyrazol-4-yl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 139431861) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is (3S)-3-methyl-1-[1-(oxan-4-yl)pyrazol-4-yl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | (3S)-3-methyl-1-[1-(oxan-4-yl)pyrazol-4-yl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 139431861 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (3S)-3-methyl-1-[1-(oxan-4-yl)pyrazol-4-yl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | C[C@H]1Cc2c([nH]c3ccccc23)C(c2cnn(C3CCOCC3)c2)N1 |
| InChI | InChI=1S/C20H24N4O/c1-13-10-17-16-4-2-3-5-18(16)23-20(17)19(22-13)14-11-21-24(12-14)15-6-8-25-9-7-15/h2-5,11-13,15,19,22-23H,6-10H2,1H3/t13-,19?/m0/s1 |
| InChIKey | HGVBXPVXTMTFGD-YTJLLHSVSA-N |
| XLogP | 3.34 |
| TPSA | 54.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|