C19H21ClN4O2 — CID 139446985
5-[(1-benzyl-3-methyl-2-oxoimidazo[4,5-b]pyridin-6-yl)amino]pentanoyl chloride (PubChem CID 139446985) has the molecular formula C19H21ClN4O2 and a molecular weight of 372.86 g/mol. Its IUPAC name is 5-[(1-benzyl-3-methyl-2-oxoimidazo[4,5-b]pyridin-6-yl)amino]pentanoyl chloride.
| Compound Name | 5-[(1-benzyl-3-methyl-2-oxoimidazo[4,5-b]pyridin-6-yl)amino]pentanoyl chloride |
|---|---|
| PubChem CID | 139446985 |
| Molecular Formula | C19H21ClN4O2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 5-[(1-benzyl-3-methyl-2-oxoimidazo[4,5-b]pyridin-6-yl)amino]pentanoyl chloride |
| SMILES | Cn1c(=O)n(Cc2ccccc2)c2cc(NCCCCC(=O)Cl)cnc21 |
| InChI | InChI=1S/C19H21ClN4O2/c1-23-18-16(24(19(23)26)13-14-7-3-2-4-8-14)11-15(12-22-18)21-10-6-5-9-17(20)25/h2-4,7-8,11-12,21H,5-6,9-10,13H2,1H3 |
| InChIKey | QOEFYVUVBGHXEH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|