C14H11ClFN5O5 — CID 139461582
4-[[4-[4-(3-chloro-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]oxy]butanamide (PubChem CID 139461582) has the molecular formula C14H11ClFN5O5 and a molecular weight of 383.72 g/mol. Its IUPAC name is 4-[[4-[4-(3-chloro-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]oxy]butanamide.
| Compound Name | 4-[[4-[4-(3-chloro-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]oxy]butanamide |
|---|---|
| PubChem CID | 139461582 |
| Molecular Formula | C14H11ClFN5O5 |
| Molecular Weight | 383.72 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 4-[[4-[4-(3-chloro-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]oxy]butanamide |
| SMILES | NC(=O)CCCOc1nonc1-c1noc(=O)n1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H11ClFN5O5/c15-8-6-7(3-4-9(8)16)21-12(19-25-14(21)23)11-13(20-26-18-11)24-5-1-2-10(17)22/h3-4,6H,1-2,5H2,(H2,17,22) |
| InChIKey | ZYRIXCFAFRHPNF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 139.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.72 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|