C30H37N9O3 — CID 139468028
2-[(6-pyrazol-1-ylpyrimidin-4-yl)amino]-4-[2-pyridin-2-yloxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid (PubChem CID 139468028) has the molecular formula C30H37N9O3 and a molecular weight of 571.69 g/mol. Its IUPAC name is 2-[(6-pyrazol-1-ylpyrimidin-4-yl)amino]-4-[2-pyridin-2-yloxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid.
| Compound Name | 2-[(6-pyrazol-1-ylpyrimidin-4-yl)amino]-4-[2-pyridin-2-yloxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
|---|---|
| PubChem CID | 139468028 |
| Molecular Formula | C30H37N9O3 |
| Molecular Weight | 571.69 g/mol |
| Exact Mass | 571.30 |
| IUPAC Name | 2-[(6-pyrazol-1-ylpyrimidin-4-yl)amino]-4-[2-pyridin-2-yloxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
| SMILES | O=C(O)C(CCN(CCCCc1ccc2c(n1)NCCC2)CCOc1ccccn1)Nc1cc(-n2cccn2)ncn1 |
| InChI | InChI=1S/C30H37N9O3/c40-30(41)25(37-26-21-27(34-22-33-26)39-17-6-15-35-39)12-18-38(19-20-42-28-9-1-3-13-31-28)16-4-2-8-24-11-10-23-7-5-14-32-29(23)36-24/h1,3,6,9-11,13,15,17,21-22,25H,2,4-5,7-8,12,14,16,18-20H2,(H,32,36)(H,40,41)(H,33,34,37) |
| InChIKey | HIISYKXYZSQFPA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 143.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.69 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|