C15H31NO3 — CID 139493099
3-amino-2,5-di(propan-2-yl)-6-(propoxymethyl)oxan-4-ol (PubChem CID 139493099) has the molecular formula C15H31NO3 and a molecular weight of 273.42 g/mol. Its IUPAC name is 3-amino-2,5-di(propan-2-yl)-6-(propoxymethyl)oxan-4-ol.
| Compound Name | 3-amino-2,5-di(propan-2-yl)-6-(propoxymethyl)oxan-4-ol |
|---|---|
| PubChem CID | 139493099 |
| Molecular Formula | C15H31NO3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.23 |
| IUPAC Name | 3-amino-2,5-di(propan-2-yl)-6-(propoxymethyl)oxan-4-ol |
| SMILES | CCCOCC1OC(C(C)C)C(N)C(O)C1C(C)C |
| InChI | InChI=1S/C15H31NO3/c1-6-7-18-8-11-12(9(2)3)14(17)13(16)15(19-11)10(4)5/h9-15,17H,6-8,16H2,1-5H3 |
| InChIKey | AAYPQSRIYJGWEH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|