C19H24N2O3 — CID 139501105
2-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxazolidin-2-yl)aniline (PubChem CID 139501105) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 2-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxazolidin-2-yl)aniline.
| Compound Name | 2-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxazolidin-2-yl)aniline |
|---|---|
| PubChem CID | 139501105 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 2-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxazolidin-2-yl)aniline |
| SMILES | CC1(C)ON(c2ccc(OCc3ccccc3)c(N)c2)OC1(C)C |
| InChI | InChI=1S/C19H24N2O3/c1-18(2)19(3,4)24-21(23-18)15-10-11-17(16(20)12-15)22-13-14-8-6-5-7-9-14/h5-12H,13,20H2,1-4H3 |
| InChIKey | PIWZGJWJXTZBHC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|