C18H18N2OS — CID 94758883
5-[(5-methyl-1,3-thiazol-2-yl)methyl]-2-phenylmethoxyaniline (PubChem CID 94758883) has the molecular formula C18H18N2OS and a molecular weight of 310.42 g/mol. Its IUPAC name is 5-[(5-methyl-1,3-thiazol-2-yl)methyl]-2-phenylmethoxyaniline.
| Compound Name | 5-[(5-methyl-1,3-thiazol-2-yl)methyl]-2-phenylmethoxyaniline |
|---|---|
| PubChem CID | 94758883 |
| Molecular Formula | C18H18N2OS |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 5-[(5-methyl-1,3-thiazol-2-yl)methyl]-2-phenylmethoxyaniline |
| SMILES | Cc1cnc(Cc2ccc(OCc3ccccc3)c(N)c2)s1 |
| InChI | InChI=1S/C18H18N2OS/c1-13-11-20-18(22-13)10-15-7-8-17(16(19)9-15)21-12-14-5-3-2-4-6-14/h2-9,11H,10,12,19H2,1H3 |
| InChIKey | NNMPYKRCVVDDAA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|