C66H68O4 — CID 139504091
[1-[2-[4-[4-(4-butylcyclohexyl)phenyl]benzoyl]oxynaphthalen-1-yl]-5,6-dihydronaphthalen-2-yl] 4-[4-(4-butylcyclohexyl)phenyl]benzoate (PubChem CID 139504091) has the molecular formula C66H68O4 and a molecular weight of 925.27 g/mol. Its IUPAC name is [1-[2-[4-[4-(4-butylcyclohexyl)phenyl]benzoyl]oxynaphthalen-1-yl]-5,6-dihydronaphthalen-2-yl] 4-[4-(4-butylcyclohexyl)phenyl]benzoate.
| Compound Name | [1-[2-[4-[4-(4-butylcyclohexyl)phenyl]benzoyl]oxynaphthalen-1-yl]-5,6-dihydronaphthalen-2-yl] 4-[4-(4-butylcyclohexyl)phenyl]benzoate |
|---|---|
| PubChem CID | 139504091 |
| Molecular Formula | C66H68O4 |
| Molecular Weight | 925.27 g/mol |
| Exact Mass | 924.51 |
| IUPAC Name | [1-[2-[4-[4-(4-butylcyclohexyl)phenyl]benzoyl]oxynaphthalen-1-yl]-5,6-dihydronaphthalen-2-yl] 4-[4-(4-butylcyclohexyl)phenyl]benzoate |
| SMILES | CCCCC1CCC(c2ccc(-c3ccc(C(=O)Oc4ccc5c(c4-c4c(OC(=O)c6ccc(-c7ccc(C8CCC(CCCC)CC8)cc7)cc6)ccc6ccccc46)C=CCC5)cc3)cc2)CC1 |
| InChI | InChI=1S/C66H68O4/c1-3-5-11-45-17-21-47(22-18-45)49-25-29-51(30-26-49)53-33-37-57(38-34-53)65(67)69-61-43-41-55-13-7-9-15-59(55)63(61)64-60-16-10-8-14-56(60)42-44-62(64)70-66(68)58-39-35-54(36-40-58)52-31-27-50(28-32-52)48-23-19-46(20-24-48)12-6-4-2/h7,9-10,13,15-16,25-48H,3-6,8,11-12,14,17-24H2,1-2H3 |
| InChIKey | VJLNTGLKARTTPI-UHFFFAOYSA-N |
| XLogP | 18.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.27 |
| LogP ≤ 5 | 18.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|