C18H31NO7 — CID 139527406
3-[2-hydroxy-2-[[(4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]ethyl]-2-[(E)-pent-2-enyl]cyclopentan-1-one (PubChem CID 139527406) has the molecular formula C18H31NO7 and a molecular weight of 373.45 g/mol. Its IUPAC name is 3-[2-hydroxy-2-[[(4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]ethyl]-2-[(E)-pent-2-enyl]cyclopentan-1-one.
| Compound Name | 3-[2-hydroxy-2-[[(4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]ethyl]-2-[(E)-pent-2-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 139527406 |
| Molecular Formula | C18H31NO7 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 3-[2-hydroxy-2-[[(4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]ethyl]-2-[(E)-pent-2-enyl]cyclopentan-1-one |
| SMILES | CC/C=C/CC1C(=O)CCC1CC(O)NC1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H31NO7/c1-2-3-4-5-11-10(6-7-12(11)21)8-14(22)19-15-17(24)16(23)13(9-20)26-18(15)25/h3-4,10-11,13-20,22-25H,2,5-9H2,1H3/b4-3+/t10?,11?,13-,14?,15?,16-,17-,18?/m1/s1 |
| InChIKey | HSLVIDQZMQBDBP-NTSKQKQNSA-N |
| XLogP | -0.96 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|