C4H12N4S2 — CID 139538674
N-methyl-N,N'-bis(methylaminosulfanyl)methanimidamide (PubChem CID 139538674) has the molecular formula C4H12N4S2 and a molecular weight of 180.30 g/mol. Its IUPAC name is N-methyl-N,N'-bis(methylaminosulfanyl)methanimidamide.
| Compound Name | N-methyl-N,N'-bis(methylaminosulfanyl)methanimidamide |
|---|---|
| PubChem CID | 139538674 |
| Molecular Formula | C4H12N4S2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | N-methyl-N,N'-bis(methylaminosulfanyl)methanimidamide |
| SMILES | CNSN=CN(C)SNC |
| InChI | InChI=1S/C4H12N4S2/c1-5-9-7-4-8(3)10-6-2/h4-6H,1-3H3 |
| InChIKey | OJXMZEACSADAOH-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|