C30H31N5O2 — CID 139552608
6-[4-amino-3-(methyliminomethyl)phenyl]-2-ethoxy-8-[4-[(Z)-1-(ethylideneamino)but-1-enyl]phenyl]-1,6-naphthyridin-7-one (PubChem CID 139552608) has the molecular formula C30H31N5O2 and a molecular weight of 493.61 g/mol. Its IUPAC name is 6-[4-amino-3-(methyliminomethyl)phenyl]-2-ethoxy-8-[4-[(Z)-1-(ethylideneamino)but-1-enyl]phenyl]-1,6-naphthyridin-7-one.
| Compound Name | 6-[4-amino-3-(methyliminomethyl)phenyl]-2-ethoxy-8-[4-[(Z)-1-(ethylideneamino)but-1-enyl]phenyl]-1,6-naphthyridin-7-one |
|---|---|
| PubChem CID | 139552608 |
| Molecular Formula | C30H31N5O2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | 6-[4-amino-3-(methyliminomethyl)phenyl]-2-ethoxy-8-[4-[(Z)-1-(ethylideneamino)but-1-enyl]phenyl]-1,6-naphthyridin-7-one |
| SMILES | C/C=N/C(=C\CC)c1ccc(-c2c(=O)n(-c3ccc(N)c(/C=N/C)c3)cc3ccc(OCC)nc23)cc1 |
| InChI | InChI=1S/C30H31N5O2/c1-5-8-26(33-6-2)20-9-11-21(12-10-20)28-29-22(13-16-27(34-29)37-7-3)19-35(30(28)36)24-14-15-25(31)23(17-24)18-32-4/h6,8-19H,5,7,31H2,1-4H3/b26-8-,32-18+,33-6+ |
| InChIKey | XAEOTFAKRQBDEF-LWRCYGTCSA-N |
| XLogP | 5.92 |
| TPSA | 94.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|