C25H34F3NO2 — CID 139554376
(2R)-2-[(8S,10aS)-3-(trifluoromethyl)-6a,7,8,9,10,10a-hexahydro-6H-benzo[c]chromen-8-yl]-1-[(4-methylcyclohexyl)methylideneamino]propan-1-ol (PubChem CID 139554376) has the molecular formula C25H34F3NO2 and a molecular weight of 437.55 g/mol. Its IUPAC name is (2R)-2-[(8S,10aS)-3-(trifluoromethyl)-6a,7,8,9,10,10a-hexahydro-6H-benzo[c]chromen-8-yl]-1-[(4-methylcyclohexyl)methylideneamino]propan-1-ol.
| Compound Name | (2R)-2-[(8S,10aS)-3-(trifluoromethyl)-6a,7,8,9,10,10a-hexahydro-6H-benzo[c]chromen-8-yl]-1-[(4-methylcyclohexyl)methylideneamino]propan-1-ol |
|---|---|
| PubChem CID | 139554376 |
| Molecular Formula | C25H34F3NO2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | (2R)-2-[(8S,10aS)-3-(trifluoromethyl)-6a,7,8,9,10,10a-hexahydro-6H-benzo[c]chromen-8-yl]-1-[(4-methylcyclohexyl)methylideneamino]propan-1-ol |
| SMILES | CC1CCC(C=NC(O)[C@H](C)[C@H]2CC[C@@H]3c4ccc(C(F)(F)F)cc4OCC3C2)CC1 |
| InChI | InChI=1S/C25H34F3NO2/c1-15-3-5-17(6-4-15)13-29-24(30)16(2)18-7-9-21-19(11-18)14-31-23-12-20(25(26,27)28)8-10-22(21)23/h8,10,12-13,15-19,21,24,30H,3-7,9,11,14H2,1-2H3/t15?,16-,17?,18+,19?,21+,24?/m1/s1 |
| InChIKey | KFCNDEVALCRASH-YZKIUYNVSA-N |
| XLogP | 6.45 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|