C15H16F3NO2 — CID 177205793
(2R,4aS,10bR)-2-methyl-8-(trifluoromethyl)-2,3,4,4a,5,10b-hexahydrochromeno[4,3-b]pyridine-1-carbaldehyde (PubChem CID 177205793) has the molecular formula C15H16F3NO2 and a molecular weight of 299.29 g/mol. Its IUPAC name is (2R,4aS,10bR)-2-methyl-8-(trifluoromethyl)-2,3,4,4a,5,10b-hexahydrochromeno[4,3-b]pyridine-1-carbaldehyde.
| Compound Name | (2R,4aS,10bR)-2-methyl-8-(trifluoromethyl)-2,3,4,4a,5,10b-hexahydrochromeno[4,3-b]pyridine-1-carbaldehyde |
|---|---|
| PubChem CID | 177205793 |
| Molecular Formula | C15H16F3NO2 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | (2R,4aS,10bR)-2-methyl-8-(trifluoromethyl)-2,3,4,4a,5,10b-hexahydrochromeno[4,3-b]pyridine-1-carbaldehyde |
| SMILES | C[C@@H]1CC[C@@H]2COc3cc(C(F)(F)F)ccc3[C@@H]2N1C=O |
| InChI | InChI=1S/C15H16F3NO2/c1-9-2-3-10-7-21-13-6-11(15(16,17)18)4-5-12(13)14(10)19(9)8-20/h4-6,8-10,14H,2-3,7H2,1H3/t9-,10-,14-/m1/s1 |
| InChIKey | PMNNORAJDVXMRJ-GPCCPHFNSA-N |
| XLogP | 3.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|