C13H14F3NO3 — CID 177005184
1-methyl-7-(trifluoromethyl)-3,4,4a,9b-tetrahydro-[1]benzofuro[3,2-b]pyridine-2,2-diol (PubChem CID 177005184) has the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. Its IUPAC name is 1-methyl-7-(trifluoromethyl)-3,4,4a,9b-tetrahydro-[1]benzofuro[3,2-b]pyridine-2,2-diol.
| Compound Name | 1-methyl-7-(trifluoromethyl)-3,4,4a,9b-tetrahydro-[1]benzofuro[3,2-b]pyridine-2,2-diol |
|---|---|
| PubChem CID | 177005184 |
| Molecular Formula | C13H14F3NO3 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 1-methyl-7-(trifluoromethyl)-3,4,4a,9b-tetrahydro-[1]benzofuro[3,2-b]pyridine-2,2-diol |
| SMILES | CN1C2c3ccc(C(F)(F)F)cc3OC2CCC1(O)O |
| InChI | InChI=1S/C13H14F3NO3/c1-17-11-8-3-2-7(13(14,15)16)6-10(8)20-9(11)4-5-12(17,18)19/h2-3,6,9,11,18-19H,4-5H2,1H3 |
| InChIKey | UBLCUPLNOLIZMF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|