C12H11F4NO — CID 172506976
(3R,9bS)-3-fluoro-7-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydro-[1]benzofuro[3,2-b]pyridine (PubChem CID 172506976) has the molecular formula C12H11F4NO and a molecular weight of 261.22 g/mol. Its IUPAC name is (3R,9bS)-3-fluoro-7-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydro-[1]benzofuro[3,2-b]pyridine.
| Compound Name | (3R,9bS)-3-fluoro-7-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydro-[1]benzofuro[3,2-b]pyridine |
|---|---|
| PubChem CID | 172506976 |
| Molecular Formula | C12H11F4NO |
| Molecular Weight | 261.22 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | (3R,9bS)-3-fluoro-7-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydro-[1]benzofuro[3,2-b]pyridine |
| SMILES | F[C@H]1CN[C@H]2c3ccc(C(F)(F)F)cc3OC2C1 |
| InChI | InChI=1S/C12H11F4NO/c13-7-4-10-11(17-5-7)8-2-1-6(12(14,15)16)3-9(8)18-10/h1-3,7,10-11,17H,4-5H2/t7-,10?,11+/m1/s1 |
| InChIKey | ZPRJKJOXLXLLHG-PEHSPWRBSA-N |
| XLogP | 2.84 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |