C12H12F3NO — CID 177205494
(4aR,9bR)-7-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydro-[1]benzofuro[3,2-b]pyridine (PubChem CID 177205494) has the molecular formula C12H12F3NO and a molecular weight of 243.23 g/mol. Its IUPAC name is (4aR,9bR)-7-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydro-[1]benzofuro[3,2-b]pyridine.
| Compound Name | (4aR,9bR)-7-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydro-[1]benzofuro[3,2-b]pyridine |
|---|---|
| PubChem CID | 177205494 |
| Molecular Formula | C12H12F3NO |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | (4aR,9bR)-7-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydro-[1]benzofuro[3,2-b]pyridine |
| SMILES | FC(F)(F)c1ccc2c(c1)O[C@@H]1CCCN[C@H]21 |
| InChI | InChI=1S/C12H12F3NO/c13-12(14,15)7-3-4-8-10(6-7)17-9-2-1-5-16-11(8)9/h3-4,6,9,11,16H,1-2,5H2/t9-,11-/m1/s1 |
| InChIKey | CHAISWFWCXEEGI-MWLCHTKSSA-N |
| XLogP | 2.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |