C15H24O2 — CID 139586899
(1R,2S,3R,5S,8S,9S)-2,6,6,8-tetramethyltricyclo[6.3.0.01,5]undec-10-ene-3,9-diol (PubChem CID 139586899) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (1R,2S,3R,5S,8S,9S)-2,6,6,8-tetramethyltricyclo[6.3.0.01,5]undec-10-ene-3,9-diol.
| Compound Name | (1R,2S,3R,5S,8S,9S)-2,6,6,8-tetramethyltricyclo[6.3.0.01,5]undec-10-ene-3,9-diol |
|---|---|
| PubChem CID | 139586899 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (1R,2S,3R,5S,8S,9S)-2,6,6,8-tetramethyltricyclo[6.3.0.01,5]undec-10-ene-3,9-diol |
| SMILES | C[C@@H]1[C@H](O)C[C@H]2C(C)(C)C[C@]3(C)[C@@H](O)C=C[C@]123 |
| InChI | InChI=1S/C15H24O2/c1-9-10(16)7-11-13(2,3)8-14(4)12(17)5-6-15(9,11)14/h5-6,9-12,16-17H,7-8H2,1-4H3/t9-,10-,11+,12+,14-,15+/m1/s1 |
| InChIKey | RPUQFKXVTKMLAL-JVHLPBCQSA-N |
| XLogP | 2.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|