C40H52 — CID 139592414
(6Z)-1,5,5-trimethyl-6-[(2E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-2,11,13,15,17-pentaen-5,9-diynylidene]cyclohexa-1,3-diene (PubChem CID 139592414) has the molecular formula C40H52 and a molecular weight of 532.86 g/mol. Its IUPAC name is (6Z)-1,5,5-trimethyl-6-[(2E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-2,11,13,15,17-pentaen-5,9-diynylidene]cyclohexa-1,3-diene.
| Compound Name | (6Z)-1,5,5-trimethyl-6-[(2E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-2,11,13,15,17-pentaen-5,9-diynylidene]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 139592414 |
| Molecular Formula | C40H52 |
| Molecular Weight | 532.86 g/mol |
| Exact Mass | 532.41 |
| IUPAC Name | (6Z)-1,5,5-trimethyl-6-[(2E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-2,11,13,15,17-pentaen-5,9-diynylidene]cyclohexa-1,3-diene |
| SMILES | CC1=CC=CC(C)(C)/C1=C\C=C(/C)CC#CC(C)CC#C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C40H52/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38-36(6)24-16-30-40(38,9)10/h13,16-17,19,21,24-28,30,32H,15,18,22-23,29H2,1-10H3/b19-13+,27-25+,31-17+,33-21+,34-26+,38-28- |
| InChIKey | MGHPBEXYABXQKA-VXUGJBDFSA-N |
| XLogP | 11.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.86 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|