C37H42N2O — CID 139611292
1,5-bis[2-(diethylamino)phenyl]-1,5-diphenylpenta-2,4-dien-1-ol (PubChem CID 139611292) has the molecular formula C37H42N2O and a molecular weight of 530.76 g/mol. Its IUPAC name is 1,5-bis[2-(diethylamino)phenyl]-1,5-diphenylpenta-2,4-dien-1-ol.
| Compound Name | 1,5-bis[2-(diethylamino)phenyl]-1,5-diphenylpenta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 139611292 |
| Molecular Formula | C37H42N2O |
| Molecular Weight | 530.76 g/mol |
| Exact Mass | 530.33 |
| IUPAC Name | 1,5-bis[2-(diethylamino)phenyl]-1,5-diphenylpenta-2,4-dien-1-ol |
| SMILES | CCN(CC)c1ccccc1C(=CC=CC(O)(c1ccccc1)c1ccccc1N(CC)CC)c1ccccc1 |
| InChI | InChI=1S/C37H42N2O/c1-5-38(6-2)35-27-17-15-24-33(35)32(30-20-11-9-12-21-30)25-19-29-37(40,31-22-13-10-14-23-31)34-26-16-18-28-36(34)39(7-3)8-4/h9-29,40H,5-8H2,1-4H3 |
| InChIKey | KVJQUXQIKWQCGB-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.76 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|