C37H41ClN2O4 — CID 73411961
[1,5-bis[2-(diethylamino)phenyl]-1,5-diphenylpenta-2,4-dienyl] perchlorate (PubChem CID 73411961) has the molecular formula C37H41ClN2O4 and a molecular weight of 613.20 g/mol. Its IUPAC name is [1,5-bis[2-(diethylamino)phenyl]-1,5-diphenylpenta-2,4-dienyl] perchlorate.
| Compound Name | [1,5-bis[2-(diethylamino)phenyl]-1,5-diphenylpenta-2,4-dienyl] perchlorate |
|---|---|
| PubChem CID | 73411961 |
| Molecular Formula | C37H41ClN2O4 |
| Molecular Weight | 613.20 g/mol |
| Exact Mass | 612.28 |
| IUPAC Name | [1,5-bis[2-(diethylamino)phenyl]-1,5-diphenylpenta-2,4-dienyl] perchlorate |
| SMILES | CCN(CC)c1ccccc1C(=CC=CC(O[Cl+3]([O-])([O-])[O-])(c1ccccc1)c1ccccc1N(CC)CC)c1ccccc1 |
| InChI | InChI=1S/C37H41ClN2O4/c1-5-39(6-2)35-27-17-15-24-33(35)32(30-20-11-9-12-21-30)25-19-29-37(44-38(41,42)43,31-22-13-10-14-23-31)34-26-16-18-28-36(34)40(7-3)8-4/h9-29H,5-8H2,1-4H3 |
| InChIKey | IWVDNAVQRBXRQO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.20 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|