C9H5Cl2NS — CID 139616094
3-(2,3-dichlorophenyl)sulfanylprop-2-enenitrile (PubChem CID 139616094) has the molecular formula C9H5Cl2NS and a molecular weight of 230.12 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)sulfanylprop-2-enenitrile.
| Compound Name | 3-(2,3-dichlorophenyl)sulfanylprop-2-enenitrile |
|---|---|
| PubChem CID | 139616094 |
| Molecular Formula | C9H5Cl2NS |
| Molecular Weight | 230.12 g/mol |
| Exact Mass | 228.95 |
| IUPAC Name | 3-(2,3-dichlorophenyl)sulfanylprop-2-enenitrile |
| SMILES | N#CC=CSc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C9H5Cl2NS/c10-7-3-1-4-8(9(7)11)13-6-2-5-12/h1-4,6H |
| InChIKey | NUSGIOPIJXTHMO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.12 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|