C30H24I4O9 — CID 139620188
ditert-butyl 2',4',5',7'-tetraiodo-3-oxospiro[2-benzofuran-1,9'-xanthene]-3',6'-dicarboperoxoate (PubChem CID 139620188) has the molecular formula C30H24I4O9 and a molecular weight of 1036.13 g/mol. Its IUPAC name is ditert-butyl 2',4',5',7'-tetraiodo-3-oxospiro[2-benzofuran-1,9'-xanthene]-3',6'-dicarboperoxoate.
| Compound Name | ditert-butyl 2',4',5',7'-tetraiodo-3-oxospiro[2-benzofuran-1,9'-xanthene]-3',6'-dicarboperoxoate |
|---|---|
| PubChem CID | 139620188 |
| Molecular Formula | C30H24I4O9 |
| Molecular Weight | 1036.13 g/mol |
| Exact Mass | 1035.76 |
| IUPAC Name | ditert-butyl 2',4',5',7'-tetraiodo-3-oxospiro[2-benzofuran-1,9'-xanthene]-3',6'-dicarboperoxoate |
| SMILES | CC(C)(C)OOC(=O)c1c(I)cc2c(c1I)Oc1c(cc(I)c(C(=O)OOC(C)(C)C)c1I)C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C30H24I4O9/c1-28(2,3)42-40-26(36)19-17(31)11-15-23(21(19)33)38-24-16(30(15)14-10-8-7-9-13(14)25(35)39-30)12-18(32)20(22(24)34)27(37)41-43-29(4,5)6/h7-12H,1-6H3 |
| InChIKey | PVJSZICWSUOBOE-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1036.13 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|