C34H35N3O7 — CID 139624573
5-O-[1-(3,4-dihydro-2H-quinolin-1-yl)-3-phenoxypropan-2-yl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 139624573) has the molecular formula C34H35N3O7 and a molecular weight of 597.67 g/mol. Its IUPAC name is 5-O-[1-(3,4-dihydro-2H-quinolin-1-yl)-3-phenoxypropan-2-yl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[1-(3,4-dihydro-2H-quinolin-1-yl)-3-phenoxypropan-2-yl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 139624573 |
| Molecular Formula | C34H35N3O7 |
| Molecular Weight | 597.67 g/mol |
| Exact Mass | 597.25 |
| IUPAC Name | 5-O-[1-(3,4-dihydro-2H-quinolin-1-yl)-3-phenoxypropan-2-yl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC(COc2ccccc2)CN2CCCc3ccccc32)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C34H35N3O7/c1-22-30(33(38)42-3)32(25-12-9-14-26(19-25)37(40)41)31(23(2)35-22)34(39)44-28(21-43-27-15-5-4-6-16-27)20-36-18-10-13-24-11-7-8-17-29(24)36/h4-9,11-12,14-17,19,28,32,35H,10,13,18,20-21H2,1-3H3 |
| InChIKey | ASILXEZIOIIXLX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.67 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|