C12H19NO9 — CID 139629217
(2S)-2-(prop-2-enoxycarbonylamino)-3-[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxypropanoic acid (PubChem CID 139629217) has the molecular formula C12H19NO9 and a molecular weight of 321.28 g/mol. Its IUPAC name is (2S)-2-(prop-2-enoxycarbonylamino)-3-[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxypropanoic acid.
| Compound Name | (2S)-2-(prop-2-enoxycarbonylamino)-3-[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxypropanoic acid |
|---|---|
| PubChem CID | 139629217 |
| Molecular Formula | C12H19NO9 |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | (2S)-2-(prop-2-enoxycarbonylamino)-3-[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxypropanoic acid |
| SMILES | C=CCOC(=O)N[C@@H](CO[C@@H]1OC[C@H](O)[C@H](O)[C@H]1O)C(=O)O |
| InChI | InChI=1S/C12H19NO9/c1-2-3-20-12(19)13-6(10(17)18)4-21-11-9(16)8(15)7(14)5-22-11/h2,6-9,11,14-16H,1,3-5H2,(H,13,19)(H,17,18)/t6-,7-,8-,9+,11+/m0/s1 |
| InChIKey | NUVLDUPDGQRSKM-HTFKAIDBSA-N |
| XLogP | -2.19 |
| TPSA | 154.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|