C22H27N7O — CID 139629820
4-[[benzyl(carbamimidoyl)amino]methyl]-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)cyclohexane-1-carboxamide (PubChem CID 139629820) has the molecular formula C22H27N7O and a molecular weight of 405.51 g/mol. Its IUPAC name is 4-[[benzyl(carbamimidoyl)amino]methyl]-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)cyclohexane-1-carboxamide.
| Compound Name | 4-[[benzyl(carbamimidoyl)amino]methyl]-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 139629820 |
| Molecular Formula | C22H27N7O |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 4-[[benzyl(carbamimidoyl)amino]methyl]-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)cyclohexane-1-carboxamide |
| SMILES | [H]/N=C(\N)N(Cc1ccccc1)CC1CCC(C(=O)Nc2ccnc3[nH]ncc23)CC1 |
| InChI | InChI=1S/C22H27N7O/c23-22(24)29(13-15-4-2-1-3-5-15)14-16-6-8-17(9-7-16)21(30)27-19-10-11-25-20-18(19)12-26-28-20/h1-5,10-12,16-17H,6-9,13-14H2,(H3,23,24)(H2,25,26,27,28,30) |
| InChIKey | UEQCUSLPOXEQCS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 123.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|