C20H24N8O6S2 — CID 139632799
5-azido-2-[2-[4-azido-2-(3-hydroxypropylsulfamoyl)phenyl]ethenyl]-N-(3-hydroxypropyl)benzenesulfonamide (PubChem CID 139632799) has the molecular formula C20H24N8O6S2 and a molecular weight of 536.60 g/mol. Its IUPAC name is 5-azido-2-[2-[4-azido-2-(3-hydroxypropylsulfamoyl)phenyl]ethenyl]-N-(3-hydroxypropyl)benzenesulfonamide.
| Compound Name | 5-azido-2-[2-[4-azido-2-(3-hydroxypropylsulfamoyl)phenyl]ethenyl]-N-(3-hydroxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 139632799 |
| Molecular Formula | C20H24N8O6S2 |
| Molecular Weight | 536.60 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | 5-azido-2-[2-[4-azido-2-(3-hydroxypropylsulfamoyl)phenyl]ethenyl]-N-(3-hydroxypropyl)benzenesulfonamide |
| SMILES | [N-]=[N+]=Nc1ccc(C=Cc2ccc(N=[N+]=[N-])cc2S(=O)(=O)NCCCO)c(S(=O)(=O)NCCCO)c1 |
| InChI | InChI=1S/C20H24N8O6S2/c21-27-25-17-7-5-15(19(13-17)35(31,32)23-9-1-11-29)3-4-16-6-8-18(26-28-22)14-20(16)36(33,34)24-10-2-12-30/h3-8,13-14,23-24,29-30H,1-2,9-12H2 |
| InChIKey | MACRYLJPRWRPOP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 230.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.60 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|