C31H42N2O2S — CID 139637025
4-[benzenesulfonyl-[4-(dibutylamino)phenyl]methyl]-N,N-diethylaniline (PubChem CID 139637025) has the molecular formula C31H42N2O2S and a molecular weight of 506.76 g/mol. Its IUPAC name is 4-[benzenesulfonyl-[4-(dibutylamino)phenyl]methyl]-N,N-diethylaniline.
| Compound Name | 4-[benzenesulfonyl-[4-(dibutylamino)phenyl]methyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 139637025 |
| Molecular Formula | C31H42N2O2S |
| Molecular Weight | 506.76 g/mol |
| Exact Mass | 506.30 |
| IUPAC Name | 4-[benzenesulfonyl-[4-(dibutylamino)phenyl]methyl]-N,N-diethylaniline |
| SMILES | CCCCN(CCCC)c1ccc(C(c2ccc(N(CC)CC)cc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H42N2O2S/c1-5-9-24-33(25-10-6-2)29-22-18-27(19-23-29)31(36(34,35)30-14-12-11-13-15-30)26-16-20-28(21-17-26)32(7-3)8-4/h11-23,31H,5-10,24-25H2,1-4H3 |
| InChIKey | ZXMGFGSGGIEGKZ-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.76 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|