C10H12O4 — CID 139638376
7-methylbicyclo[2.2.1]hept-2-ene-1,4-dicarboxylic acid (PubChem CID 139638376) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is 7-methylbicyclo[2.2.1]hept-2-ene-1,4-dicarboxylic acid.
| Compound Name | 7-methylbicyclo[2.2.1]hept-2-ene-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 139638376 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 7-methylbicyclo[2.2.1]hept-2-ene-1,4-dicarboxylic acid |
| SMILES | CC1C2(C(=O)O)C=CC1(C(=O)O)CC2 |
| InChI | InChI=1S/C10H12O4/c1-6-9(7(11)12)2-3-10(6,5-4-9)8(13)14/h2-3,6H,4-5H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | FPYLUZFSLRDGBT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|