C22H28NO2P — CID 139648135
butyl 3-(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate (PubChem CID 139648135) has the molecular formula C22H28NO2P and a molecular weight of 369.45 g/mol. Its IUPAC name is butyl 3-(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate.
| Compound Name | butyl 3-(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139648135 |
| Molecular Formula | C22H28NO2P |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | butyl 3-(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(CP(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C22H28NO2P/c1-2-3-16-25-22(24)23-15-14-19(17-23)18-26(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-13,19H,2-3,14-18H2,1H3 |
| InChIKey | PDERWHFBAFVZGG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|