C17H16F3N3S — CID 139649364
N-[1H-benzimidazol-2-ylsulfanyl(phenyl)methyl]-2,2,2-trifluoro-N-methylethanamine (PubChem CID 139649364) has the molecular formula C17H16F3N3S and a molecular weight of 351.40 g/mol. Its IUPAC name is N-[1H-benzimidazol-2-ylsulfanyl(phenyl)methyl]-2,2,2-trifluoro-N-methylethanamine.
| Compound Name | N-[1H-benzimidazol-2-ylsulfanyl(phenyl)methyl]-2,2,2-trifluoro-N-methylethanamine |
|---|---|
| PubChem CID | 139649364 |
| Molecular Formula | C17H16F3N3S |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N-[1H-benzimidazol-2-ylsulfanyl(phenyl)methyl]-2,2,2-trifluoro-N-methylethanamine |
| SMILES | CN(CC(F)(F)F)C(Sc1nc2ccccc2[nH]1)c1ccccc1 |
| InChI | InChI=1S/C17H16F3N3S/c1-23(11-17(18,19)20)15(12-7-3-2-4-8-12)24-16-21-13-9-5-6-10-14(13)22-16/h2-10,15H,11H2,1H3,(H,21,22) |
| InChIKey | SOZXVROIQVARCY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|