C6H13NO3 — CID 139665334
(2S)-2-(deuteriomethylamino)-3-hydroxy-3-methylbutanoic acid (PubChem CID 139665334) has the molecular formula C6H13NO3 and a molecular weight of 148.18 g/mol. Its IUPAC name is (2S)-2-(deuteriomethylamino)-3-hydroxy-3-methylbutanoic acid.
| Compound Name | (2S)-2-(deuteriomethylamino)-3-hydroxy-3-methylbutanoic acid |
|---|---|
| PubChem CID | 139665334 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 148.18 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | (2S)-2-(deuteriomethylamino)-3-hydroxy-3-methylbutanoic acid |
| SMILES | [2H]CN[C@H](C(=O)O)C(C)(C)O |
| InChI | InChI=1S/C6H13NO3/c1-6(2,10)4(7-3)5(8)9/h4,7,10H,1-3H3,(H,8,9)/t4-/m1/s1/i3D |
| InChIKey | OMDFZKXSWRGNGX-SBYFXDDNSA-N |
| XLogP | -0.57 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.18 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |