C17H21F3O — CID 139673871
1-(difluoromethoxy)-3-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]benzene (PubChem CID 139673871) has the molecular formula C17H21F3O and a molecular weight of 298.35 g/mol. Its IUPAC name is 1-(difluoromethoxy)-3-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]benzene.
| Compound Name | 1-(difluoromethoxy)-3-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 139673871 |
| Molecular Formula | C17H21F3O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 1-(difluoromethoxy)-3-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]benzene |
| SMILES | FCC/C=C/C1CCC(c2cccc(OC(F)F)c2)CC1 |
| InChI | InChI=1S/C17H21F3O/c18-11-2-1-4-13-7-9-14(10-8-13)15-5-3-6-16(12-15)21-17(19)20/h1,3-6,12-14,17H,2,7-11H2/b4-1+ |
| InChIKey | ORILADUBPIUMAO-DAFODLJHSA-N |
| XLogP | 5.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|